
Catalog Number	AR01DPF2
Chemical Name	Avermectin A1a,5-O-demethyl-25-de(1-methylpropyl)-25-(1-methylethyl)-
CAS Number	65195-56-4
Molecular Formula	C47H70O14
Molecular Weight	859.0503000000004
MDL Number	MFCD03701301
SMILES	CO[C@H]1C[C@@H](O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C)O[C@H]1[C@@H](C)/C=C/C=C/2\CO[C@H]3[C@]2(O)[C@@H](C=C([C@H]3O)C)C(=O)O[C@H]2C[C@@H](C/C=C/1\C)O[C@]1(C2)C=C[C@@H]([C@H](O1)C(C)C)C

Avermectin B1b, a natural product derived from the bacterium Streptomyces avermitilis, has found widespread application in chemical synthesis as a valuable building block for the creation of various compounds. Due to its unique structure and functional groups, Avermectin B1b serves as a versatile starting material in the synthesis of complex molecules and drugs. One key application of Avermectin B1b in chemical synthesis is its use as a precursor for the preparation of semi-synthetic derivatives with enhanced properties. By modifying specific sites on the Avermectin B1b molecule, chemists can tailor the resulting compounds for specific applications, such as improved stability, increased potency, or better solubility. This versatility makes Avermectin B1b an essential tool in the development of new pharmaceuticals and agrochemicals.Furthermore, Avermectin B1b's structural features make it an ideal candidate for use in various coupling reactions and functional group transformations. Its multiple reactive sites allow for selective modifications, enabling chemists to introduce diverse chemical functionalities with precision. As a result, Avermectin B1b plays a crucial role in the synthesis of structurally complex molecules that are challenging to access through other means.In summary, Avermectin B1b's role in chemical synthesis extends beyond its natural bioactivity, showcasing its value as a valuable starting material for the creation of novel compounds with a wide range of applications.