
Catalog Number	AR00H7ZE
Chemical Name	1H-Indazole, 1-acetyl-6-bromo-
CAS Number	651780-33-5
Molecular Formula	C9H7BrN2O
Molecular Weight	239.0687
MDL Number	MFCD14560558
SMILES	Brc1ccc2c(c1)n(nc2)C(=O)C

1H-Indazole, 1-acetyl-6-bromo- is a valuable compound widely used in chemical synthesis as a versatile building block. It serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and advanced materials. With its unique structure and reactivity, this compound plays a crucial role in the development of new molecules with improved properties and functionalities. In organic synthesis, 1H-Indazole, 1-acetyl-6-bromo- acts as a crucial precursor for the introduction of functional groups, such as acetyl and bromo moieties, enabling the synthesis of diverse molecular structures. Its compatibility with a range of chemical reactions makes it a valuable tool for constructing complex organic compounds efficiently and selectively. Chemists utilize this compound in the preparation of drug candidates, natural product derivatives, and fine chemicals, harnessing its synthetic potential to advance research and development in various fields of chemistry.