
Catalog Number	AR006TE9
Chemical Name	5-Bromo-2,4-difluorobenzoic acid
CAS Number	651027-08-6
Molecular Formula	C13H17BrF2O2Si
Molecular Weight	351.2592
MDL Number	MFCD04115714
SMILES	CC[Si](c1c(F)c(cc(c1F)Br)C(=O)O)(CC)CC

In chemical synthesis, 5-Bromo-2,4-difluoro-3-(triethylsilyl)benzoic acid serves as a versatile building block for the creation of various advanced organic compounds. This compound can be employed as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials due to its unique structural properties. Its trifluoromethyl group confers enhanced chemical reactivity and stability, making it a valuable tool in the design and production of complex molecules. By utilizing 5-Bromo-2,4-difluoro-3-(triethylsilyl)benzoic acid, chemists can access novel compounds with tailored properties for a wide range of applications in the fields of medicine, agriculture, and materials science.