
Catalog Number	AR00F4MX
Chemical Name	2-(6-methyl-2-quinolyl)-1H-indene-1,3(2H)-dione
CAS Number	6493-58-9
Molecular Formula	C19H13NO2
Molecular Weight	287.312
MDL Number	MFCD00777822
SMILES	Cc1ccc2c(c1)ccc(n2)C1C(=O)c2c(C1=O)cccc2

The compound 2-(6-Methyl-2-quinolinyl)-1H-indene-1,3(2H)-dione has significant applications in organic chemical synthesis as a versatile building block. Its unique structure with a quinoline moiety attached to an indene-dione scaffold provides diverse opportunities for creating novel molecules and functional materials. In chemical synthesis, this compound can serve as a key intermediate for the production of various pharmaceuticals, agrochemicals, and dyes. Its quinoline ring can participate in a range of important organic reactions such as nucleophilic substitution, oxidation, and reduction, allowing for the introduction of different functional groups. The indene-dione core, on the other hand, offers opportunities for cyclization and heterocyclic chemistry, enabling the formation of complex structures with potentially valuable properties.Moreover, the presence of a methyl group at the 6-position of the quinoline ring can influence the compound's reactivity and selectivity in chemical transformations, leading to tailored synthesis routes for specific target molecules. Overall, 2-(6-Methyl-2-quinolinyl)-1H-indene-1,3(2H)-dione plays a crucial role in advancing the field of organic synthesis by enabling the efficient construction of diverse molecular architectures with potential applications in various industries.