
Catalog Number	AR01E5N1
Chemical Name	Ethyl3-Oxo-5-(phenylmethoxy)-pentanoicAcidEster
CAS Number	64714-79-0
Molecular Formula	C14H18O4
Molecular Weight	250.2903
MDL Number	MFCD26401277
SMILES	CCOC(=O)CC(=O)CCOCc1ccccc1

Pentanoic acid, 3-oxo-5-(phenylmethoxy)-, ethyl ester is a versatile compound widely utilized in chemical synthesis for its ability to serve as a building block in the creation of various organic molecules. It is commonly employed as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals due to its structural flexibility and reactivity. Additionally, its unique properties make it a valuable precursor in the development of novel materials and functional organic compounds. With its strategic role in the synthesis of complex molecules, this compound plays a crucial part in advancing research and innovation in the field of organic chemistry.