
Catalog Number	AR01DQP9
Chemical Name	2H-1-Benzopyran-3-carboxylic acid,7-(b-D-galactopyranosyloxy)-2-oxo-
CAS Number	64664-99-9
Molecular Formula	C16H16O10
Molecular Weight	368.2922
MDL Number	MFCD00153934
SMILES	OC[C@H]1O[C@@H](Oc2ccc3c(c2)oc(=O)c(c3)C(=O)O)[C@@H]([C@H]([C@H]1O)O)O

In chemical synthesis, 2-Oxo-7-(((2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-2H-chromene-3-carboxylic acid serves as a versatile building block for the creation of novel compounds. Its unique structure and functional groups make it a valuable intermediate in organic reactions, allowing for the formation of complex molecules with specific properties. By incorporating this compound into synthetic pathways, chemists can access a wide range of derivatives and analogs, expanding the possibilities for drug discovery, material science, and other research fields.