
Catalog Number	AR00E9U8
Chemical Name	2-pyridylmethyl 2-(4-isobutylphenyl)propionate
CAS Number	64622-45-3
Molecular Formula	C19H23NO2
Molecular Weight	297.3914
MDL Number	MFCD00866018
SMILES	CC(Cc1ccc(cc1)C(C(=O)OCc1ccccn1)C)C

Ibuprofen piconol, also known as ibuprofen dolamine, is a derivative of the nonsteroidal anti-inflammatory drug ibuprofen. It is commonly utilized in chemical synthesis as a prodrug form of ibuprofen, providing improved water solubility and enhanced absorption in the gastrointestinal tract. In chemical reactions, Ibuprofen piconol can serve as a versatile building block for the synthesis of various pharmaceutical compounds, especially those requiring the anti-inflammatory and analgesic effects of ibuprofen. Moreover, its prodrug nature allows for controlled release of ibuprofen in the body, making it a valuable tool in the development of novel drug formulations.