
Catalog Number	AR01J72H
Chemical Name	4-Piperidinecarboxylic acid, 4-(4-fluorophenyl)-, hydrochloride
CAS Number	644981-88-4
Molecular Formula	C12H15ClFNO2
Molecular Weight	259.7044
MDL Number	MFCD32688437
SMILES	OC(=O)C1(CCNCC1)c1ccc(cc1)F.Cl

4-Piperidinecarboxylic acid, 4-(4-fluorophenyl)-, hydrochloride is a versatile compound widely used in chemical synthesis as a key building block in the production of pharmaceuticals and fine chemicals. This compound serves as a crucial intermediate in the synthesis of various biologically active molecules, including pharmaceutical drugs and agrochemicals. Its unique structure and reactivity make it valuable for the creation of complex organic compounds through various synthetic pathways. Researchers and chemists utilize this compound in the development of new pharmaceutical agents, potential drug candidates, and other specialized chemicals due to its significant role as a foundational structural component in organic synthesis.