
Catalog Number	AR01JSUV
Chemical Name	6-hydroxy-9-(4-methoxy-2-methylphenyl)-3H-xanthen-3-one
CAS Number	643755-84-4
Molecular Formula	C21H16O4
Molecular Weight	332.3493
MDL Number	MFCD30471512
SMILES	COc1ccc(c(c1)C)c1c2ccc(=O)cc2oc2c1ccc(c2)O

6-Hydroxy-9-(4-methoxy-2-methylphenyl)-3H-xanthen-3-one, known for its unique chemical structure, finds a significant application in organic chemical synthesis. This compound serves as a versatile building block for the preparation of various organic molecules and materials due to its reactive hydroxyl group and substituted xanthene moiety. In chemical synthesis, it acts as a key intermediate in the formation of complex organic compounds with diverse functionalities. By employing strategic chemical reactions, this compound can be modified and functionalized to introduce specific chemical groups or bonds, allowing for the tailored synthesis of target molecules with desired properties and applications. The incorporation of 6-Hydroxy-9-(4-methoxy-2-methylphenyl)-3H-xanthen-3-one in organic synthesis enables the development of novel compounds for pharmaceuticals, agrochemicals, materials science, and other industrial applications.