
Catalog Number	AR00EGL1
Chemical Name	METHYL 4,7-DICHLORO-QUINOLINE-2-CARBOXYLATE
CAS Number	643044-04-6
Molecular Formula	C11H7Cl2NO2
Molecular Weight	256.0848
MDL Number	MFCD08458392
SMILES	COC(=O)c1cc(Cl)c2c(n1)cc(cc2)Cl

Methyl 4,7-dichloroquinoline-2-carboxylate is a valuable compound widely utilized in chemical synthesis processes. This compound serves as a key building block in the creation of various important pharmaceuticals, agrochemicals, and materials.One of the primary applications of Methyl 4,7-dichloroquinoline-2-carboxylate is in the synthesis of novel drug candidates. Its unique structure and reactivity make it an attractive starting material for the preparation of biologically active compounds targeting specific disease pathways. By incorporating this compound into the synthesis of drug intermediates, researchers can explore new avenues for drug discovery and development.Furthermore, Methyl 4,7-dichloroquinoline-2-carboxylate plays a crucial role in the development of agrochemicals. Its versatile nature allows for the modification of chemical structures to enhance the efficacy and safety of agricultural products. By introducing this compound into the synthesis of pesticide or herbicide formulations, scientists can create innovative solutions for pest control and crop protection.In materials science, Methyl 4,7-dichloroquinoline-2-carboxylate can be utilized to design functional materials with tailored properties. By incorporating this compound into the synthesis of polymers, dyes, or catalysts, researchers can fine-tune the characteristics of the final material for specific applications, such as electronics, coatings, or sensors.Overall, the versatility and reactivity of Methyl 4,7-dichloroquinoline-2-carboxylate make it a valuable tool in chemical synthesis, enabling the creation of diverse compounds with potential applications in pharmaceuticals, agrochemicals, and materials science.