
Catalog Number	AR01E5MP
Chemical Name	(+)-AnatoxinA
CAS Number	64285-06-9
Molecular Formula	C14H19NO5
Molecular Weight	281.3044
SMILES	CC(=O)C1=CCCC2NC1CC2.OC(=O)/C=C/C(=O)O

Anatoxin a, a potent neurotoxin produced by certain species of cyanobacteria, has found application in chemical synthesis as a valuable tool for the development of pharmaceuticals and agrochemicals. This compound's unique structure and mechanism of action make it a versatile reagent in organic chemistry, particularly in the field of alkaloid synthesis. By leveraging Anatoxin a's reactivity, chemists can introduce complex nitrogen-containing functionalities into molecules, opening up routes to novel bioactive compounds. Additionally, Anatoxin a's ability to selectively target and modulate specific neural receptors has paved the way for the exploration of new drug candidates with potential applications in neuroscience and drug discovery.