
Catalog Number	AR00EKYC
Chemical Name	(+)-Polyneuridine
CAS Number	639-36-1
Molecular Formula	C21H24N2O3
Molecular Weight	352.4269
MDL Number	MFCD26406181
SMILES	C/C=C\1/CN2[C@H]3C[C@@H]1[C@]([C@@H]2Cc1c3[nH]c2c1cccc2)(CO)C(=O)OC

Akuammidine is a naturally occurring alkaloid found in the seeds of the Picralima nitida tree, commonly known as the Akuamma tree. In chemical synthesis, akuammidine serves as a versatile building block due to its unique structural features and reactivity.One of the key applications of akuammidine in chemical synthesis is its role as a precursor for the synthesis of various biologically active compounds. By leveraging its structural elements, chemists can easily modify akuammidine to introduce specific functional groups or moieties that are essential for the desired biological activity.Furthermore, akuammidine can be used as a starting material for the construction of complex organic molecules through various synthetic transformations such as carbon-carbon or carbon-nitrogen bond formations. Its reactivity and compatibility with different reaction conditions make it a valuable tool in the synthesis of pharmaceuticals, natural products, and other important chemical entities.Overall, the application of akuammidine in chemical synthesis highlights its significance as a key intermediate in the preparation of diverse compounds with potential medicinal and industrial applications.