
Catalog Number	AR01JDOA
Chemical Name	Ethanol, 2-[[(2-nitrophenyl)methyl]thio]-
CAS Number	638994-72-6
Molecular Formula	C9H11NO3S
Molecular Weight	213.2535
MDL Number	MFCD04308185
SMILES	OCCSCc1ccccc1[N+](=O)[O-]

The compound Ethanol, 2-[[(2-nitrophenyl)methyl]thio]- is a valuable reagent commonly used in chemical synthesis for various applications. It serves as a key building block in the creation of complex organic molecules through a variety of reactions. Its unique structure, incorporating a nitrophenyl group and a thioether linkage, offers specific reactivity and functionality that enables precise manipulation in synthetic processes.In chemical synthesis, Ethanol, 2-[[(2-nitrophenyl)methyl]thio]- can act as a precursor in the formation of more intricate molecules with desired properties. Its sulfur-containing thioether group can participate in substitution reactions, while the nitrophenyl moiety can undergo reduction or functional group transformations. These characteristics make it a versatile component in the construction of pharmaceuticals, agrochemicals, and materials where precise control over molecular structure is crucial.Researchers and chemists utilize Ethanol, 2-[[(2-nitrophenyl)methyl]thio]- to synthesize diverse products, from targeted drug compounds to advanced polymers, by employing various synthetic methodologies. By harnessing its reactivity and compatibility with other reagents, this compound plays a pivotal role in advancing the field of organic synthesis and driving innovation in material science and medicinal chemistry.