
Catalog Number	AR00EEG9
Chemical Name	METHYL PERFLUORO(5-METHYL-4,7-DIOXANON-8-ENOATE)
CAS Number	63863-43-4
Molecular Formula	C9H3F13O4
Molecular Weight	422.097
MDL Number	MFCD08460494
SMILES	COC(=O)C(C(OC(C(OC(=C(F)F)F)(F)F)(C(F)(F)F)F)(F)F)(F)F

Methyl 3-[1-[difluoro[(1,2,2-trifluoroethenyl)oxy]methyl]-1,2,2,2-tetrafluoroethoxy]-2,2,3,3-tetrafluoropropanoate is a versatile compound utilized in chemical synthesis for its unique properties. This compound serves as a valuable building block in the creation of specialized fluorinated organic molecules. Its structure containing multiple fluorine atoms makes it ideal for introducing fluorinated moieties into target molecules during synthesis processes. By incorporating this compound into reactions, chemists can introduce specific functional groups that enhance the properties of the final products, such as increased chemical stability or altered reactivity. The presence of fluorine atoms in this compound also imparts lipophilic properties, which can be advantageous in the development of pharmaceuticals or materials with specific solubility requirements. Overall, the application of Methyl 3-[1-[difluoro[(1,2,2-trifluoroethenyl)oxy]methyl]-1,2,2,2-tetrafluoroethoxy]-2,2,3,3-tetrafluoropropanoate in chemical synthesis offers researchers a powerful tool for designing and synthesizing novel compounds with tailored properties and functionalities.