
Catalog Number	AR00IBZ0
Chemical Name	Olean-12-en-3-one
CAS Number	638-97-1
Molecular Formula	C30H48O
Molecular Weight	424.7015
MDL Number	MFCD04972118
SMILES	O=C1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C)(C)CC1)C)C)C

Beta-Amyrone, a bicyclic triterpenoid compound, serves as a versatile building block in chemical synthesis. Due to its unique structural features, beta-Amyrone is widely utilized as a key intermediate for the preparation of various complex organic molecules. In organic synthesis, beta-Amyrone can undergo a range of transformations including functional group modifications, ring expansions, and cyclization reactions. Its reactive double bonds and functional groups enable the introduction of new chemical entities, making it a valuable tool for creating diverse molecular structures. Moreover, the presence of multiple sites for derivatization allows for the construction of molecule libraries and the exploration of structure-activity relationships in drug discovery and development. Additionally, beta-Amyrone’s structural complexity and stereochemical properties make it a fascinating target for total synthesis efforts, driving advancements in synthetic methodologies and strategies. Its role in chemical synthesis extends beyond traditional organic reactions, into the realms of bioconjugation, materials science, and natural product synthesis, highlighting its broad utility and importance in modern chemistry research.