
Catalog Number	AR01CCEK
Chemical Name	2,4-Imidazolidinedione,5,5-dimethyl-3-[4-nitro-3-(trifluoromethyl)phenyl]-
CAS Number	63612-50-0
Molecular Formula	C12H10F3N3O4
Molecular Weight	317.2207
MDL Number	MFCD00864670
SMILES	O=C1NC(C(=O)N1c1ccc(c(c1)C(F)(F)F)[N+](=O)[O-])(C)C
NSC Number	758683

Nilutamide, also known by its trade name Nilandron, is a nonsteroidal antiandrogen drug that is primarily used in the treatment of advanced prostate cancer. In chemical synthesis, Nilutamide serves as a valuable reagent due to its unique structural and functional properties. When employed in chemical reactions, Nilutamide can act as a building block for the creation of novel compounds, offering opportunities for the development of new pharmaceuticals or research tools. Its ability to modulate androgen receptors makes it a versatile tool in the synthesis of bioactive molecules with potential applications in the field of medicinal chemistry. By incorporating Nilutamide into synthetic pathways, chemists can explore its interactions with target molecules and design innovative compounds with enhanced biological activities.