
Catalog Number	AR00EACB
Chemical Name	Benzoic acid, 2-(2,4,5,7-tetrabromo-6-hydroxy-3-oxo-3H-xanthen-9-yl)-,ethyl ester, potassium salt
CAS Number	6359-05-3
Molecular Formula	C22H11Br4KO5
Molecular Weight	714.0340
MDL Number	MFCD00005039
SMILES	CCOC(=O)c1ccccc1c1c2cc(Br)c(c(c2oc2c1cc(Br)c(=O)c2Br)Br)[O-].[K+]

Ethyl eosin is commonly utilized in chemical synthesis as a versatile dye molecule that possesses unique properties desirable for various applications. In organic chemistry, it is often employed as a pH indicator due to its reversible color change in response to pH levels, making it a valuable tool in titrations and other analytical techniques where monitoring acidity or basicity is crucial. Additionally, Ethyl eosin can serve as a fluorescence marker in bioconjugation reactions, allowing for the visualization and tracking of biomolecules in biological systems. With its ability to seamlessly integrate into molecular structures, Ethyl eosin plays a pivotal role in the design and development of advanced materials and pharmaceutical compounds.