
Catalog Number	AR01NW6B
Chemical Name	2′,3′-Didehydro-3′-deoxy-4′-ethynylthymidine
CAS Number	634907-30-5
Molecular Formula	C12H12N2O4
Molecular Weight	248.2347
MDL Number	MFCD28502139
SMILES	Cc1cn([C@@H]2O[C@@](C=C2)(CO)C#C)c(=O)[nH]c1=O

2′,3′-Didehydro-3′-deoxy-4′-ethynylthymidine is a molecule that finds wide application in chemical synthesis, particularly in the field of medicinal chemistry and drug development. This compound serves as a key building block in the synthesis of nucleoside analogs with potent antiviral properties. Its unique structure, characterized by the presence of an ethynyl group, imparts distinct properties that are crucial in the design and development of novel pharmaceutical agents.In chemical synthesis, 2′,3′-Didehydro-3′-deoxy-4′-ethynylthymidine is often utilized as a precursor for the preparation of modified nucleosides that exhibit enhanced bioactivity and pharmacokinetic profiles. By incorporating this compound into the structure of nucleoside analogs, researchers can tailor the properties of the resulting molecules to target specific viral infections or diseases. Furthermore, the ethynyl moiety present in 2′,3′-Didehydro-3′-deoxy-4′-ethynylthymidine can serve as a versatile functional group for further derivatization, allowing for the creation of diverse analogs with varied biological activities.Overall, the strategic use of 2′,3′-Didehydro-3′-deoxy-4′-ethynylthymidine in chemical synthesis enables the synthesis of biologically active compounds with tailored properties, making it a valuable tool in the development of new pharmaceuticals with potential therapeutic applications.