
Catalog Number	AR00ELCG
Chemical Name	5-(Chloroacetyl)-8-(phenylmethoxy)-2(1H)-quinolinone
CAS Number	63404-86-4
Molecular Formula	C18H14ClNO3
Molecular Weight	327.7617
MDL Number	MFCD22200711
SMILES	ClCC(=O)c1ccc(c2c1ccc(=O)[nH]2)OCc1ccccc1

The chemical compound 8-(Benzyloxy)-5-(2-chloroacetyl)quinolin-2(1H)-one is a versatile reagent commonly used in organic synthesis for various applications. Its unique structure and reactive groups make it a valuable building block in the synthesis of complex molecules, particularly in the pharmaceutical industry.This compound can act as a key intermediate in the synthesis of bioactive molecules, including pharmaceuticals and agrochemicals. The benzyl ether group provides stability to the molecule while the chloroacetyl group offers a reactive site for further functionalization. By utilizing the selective reactivity of these functional groups, chemists can efficiently introduce diverse substituents or modify the molecular structure to fine-tune the properties of the final product.Furthermore, 8-(Benzyloxy)-5-(2-chloroacetyl)quinolin-2(1H)-one can participate in various types of chemical reactions such as nucleophilic substitution, reduction, and cross-coupling reactions, enabling the synthesis of a wide range of complex molecules with desired functionalities. Its applications extend to the preparation of drug candidates, natural product analogs, and materials with specific properties.Overall, this compound serves as a valuable tool for chemists engaged in the design and synthesis of novel molecules with potential applications in drug discovery, materials science, and other fields requiring precise control over molecular structure and reactivity.