
Catalog Number	AR00E9HH
Chemical Name	N-Methyl-2,4-dinitro-N-phenyl-6-(trifluoromethyl)aniline
CAS Number	63333-32-4
Molecular Formula	C14H10F3N3O4
Molecular Weight	341.2421
MDL Number	MFCD10000643
SMILES	CN(c1c(cc(cc1C(F)(F)F)[N+](=O)[O-])[N+](=O)[O-])c1ccccc1

N-Methyl-2,4-dinitro-N-phenyl-6-(trifluoromethyl)benzenamine is a versatile compound widely used in chemical synthesis. Its unique structure makes it a valuable building block in the creation of various organic compounds, including pharmaceuticals, agrochemicals, and specialty chemicals.In organic synthesis, N-Methyl-2,4-dinitro-N-phenyl-6-(trifluoromethyl)benzenamine serves as a key intermediate for the preparation of complex molecules. Its trifluoromethyl group provides enhanced chemical reactivity and can be selectively modified to introduce specific functional groups to the final product. Additionally, the presence of the dinitro and phenyl groups allows for further diversification through various chemical reactions, such as reduction, substitution, and coupling reactions.Furthermore, the N-methyl substituent provides steric effects that can influence the overall reactivity and selectivity of the compound, making it a valuable tool for fine-tuning the synthesis of desired molecules. Overall, N-Methyl-2,4-dinitro-N-phenyl-6-(trifluoromethyl)benzenamine plays a crucial role in modern chemical synthesis by enabling the efficient construction of complex organic compounds with tailored properties and functionalities.