
Catalog Number	AR00EA4S
Chemical Name	4-NITROPHENOL SODIUM SALT DIHYDRATE
CAS Number	63317-67-9
Molecular Formula	C6H6NNaO4
Molecular Weight	179.1059
MDL Number	MFCD00044673
SMILES	[O-]c1ccc(cc1)[N+](=O)[O-].O.[Na+]

Sodium 4-nitrophenolate dihydrate, a chemical compound highly valued in chemical synthesis, serves as a versatile reagent in numerous synthetic processes. Its unique properties make it a crucial component in various reactions, particularly in organic chemistry. The compound's ability to function as a strong nucleophile allows for efficient transformations, such as nucleophilic aromatic substitution reactions. By introducing Sodium 4-nitrophenolate dihydrate into a reaction mixture, chemists can achieve selective functional group modifications and generate novel molecular structures with high precision. Additionally, the compound's solubility characteristics enhance its utility in solution-phase chemistry, facilitating homogeneous reaction conditions and promoting optimal yields of desired products. Its application extends across diverse domains of chemical synthesis, making it an indispensable tool for researchers and practitioners seeking to synthesize complex molecules with tailored properties and functionalities.