
Catalog Number	AR01R8N1
Chemical Name	6H-Purin-6-one, 2-amino-9-[(Z)-[2,2-bis(hydroxymethyl)cyclopropylidene]methyl]-1,9-dihydro-
CAS Number	632325-71-4
Molecular Formula	C11H13N5O3
Molecular Weight	263.2526
SMILES	OCC1(CO)C/C/1=C/n1cnc2c1[nH]c(N)nc2=O

2-Amino-9-[(Z)-[2,2-bis(hydroxymethyl)cyclopropylidene]methyl]-1,9-dihydro-6H-purin-6-one, commonly known as $name$, is a versatile compound widely utilized in chemical synthesis. Its unique structure and reactivity make it a valuable building block for the synthesis of complex organic molecules. In chemical synthesis, $name$ serves as a key intermediate for the construction of diverse purine-based compounds with potential applications in pharmaceuticals, materials science, and biological research. By incorporating $name$ into synthetic pathways, chemists can access a diverse array of molecular structures, enabling the creation of novel compounds with tailored properties and functionalities.