
Catalog Number	AR003IUV
Chemical Name	4,5-METHYLENEDIOXY-2-NITROCINNAMIC ACID
CAS Number	6315-90-8
Molecular Formula	C10H7NO6
Molecular Weight	237.1657
MDL Number	MFCD00063250
SMILES	[O-][N+](=O)c1cc2OCOc2cc1/C=C/C(=O)O

The compound 3-(6-Nitrobenzo[d][1,3]dioxol-5-yl)acrylic acid is a valuable building block in chemical synthesis due to its versatile reactivity and functional groups. It can be utilized as a key intermediate in the preparation of various organic compounds with pharmaceutical, agrochemical, or material science applications. One key application is as a precursor for the synthesis of novel heterocyclic compounds with potential biological activity. Additionally, it can serve as a starting material for the development of new materials with tailored properties. Lastly, the presence of both a nitro group and an acrylic acid functionality allows for selective derivatization, enabling the introduction of different functional groups for specific applications.