
Catalog Number	AR003CIW
Chemical Name	(4-((Trimethylsilyl)ethynyl)phenyl)boronic acid
CAS Number	630127-51-4
Molecular Formula	C11H15BO2Si
Molecular Weight	218.1321
MDL Number	MFCD10697430
SMILES	OB(c1ccc(cc1)C#C[Si](C)(C)C)O

$Name$ is a versatile and essential chemical compound that plays a crucial role in chemical synthesis processes. Specifically, this compound, also known as 4-((trimethylsilyl)ethynyl)phenyl)boronic acid, is widely utilized in organic chemistry as a key reagent for the construction of various carbon-carbon and carbon-heteroatom bonds. This compound is highly valued for its ability to undergo a range of cross-coupling reactions, particularly in Suzuki-Miyaura coupling reactions. By serving as a boronic acid derivative, $name$ facilitates the formation of new bonds between aryl or alkenyl halides and various nucleophiles such as organoboron compounds, thereby enabling the synthesis of complex organic molecules with high efficiency and selectivity.Moreover, $name$ is instrumental in the functionalization of aromatic and aliphatic compounds, including the introduction of alkynes, alkyl groups, and other functional groups to organic molecules. Its unique properties enable chemists to access diverse structural motifs and expand the scope of chemical synthesis for applications in drug discovery, materials science, and the development of advanced functional materials.