
Catalog Number	AR01CCVI
Chemical Name	DL-Lysine Acetylsalicylate
CAS Number	62952-06-1
Molecular Formula	C15H22N2O6
Molecular Weight	326.345
MDL Number	MFCD00864299
SMILES	CC(=O)Oc1ccccc1C(=O)[O-].[NH3+]CCCCC(C(=O)O)N

Aspisol, a common brand name for the chemical compound aspirin, is widely used in chemical synthesis as a versatile building block. Its unique properties make it a valuable tool in organic chemistry for the preparation of various pharmaceuticals and fine chemicals. Aspisol is particularly useful in acetylation reactions, where it serves as a source of acetyl groups. This functionality allows for the modification of other molecules, enabling the synthesis of new compounds with specific desired properties. Additionally, Aspisol's anti-inflammatory and analgesic properties make it an interesting candidate for the development of novel drug molecules with improved therapeutic effects. In summary, Aspisol plays a crucial role in chemical synthesis by providing a key starting material that can be manipulated to yield diverse products with potential applications in the pharmaceutical industry.