
Catalog Number	AR00EMIA
Chemical Name	1-(2-methylbutan-2-yl)-4-nitro-benzene
CAS Number	6284-98-6
Molecular Formula	C11H15NO2
Molecular Weight	193.2423
MDL Number	MFCD23135369
SMILES	CCC(c1ccc(cc1)[N+](=O)[O-])(C)C

1-Nitro-4-(tert-pentyl)benzene, also known as $name$, is a versatile compound widely utilized in chemical synthesis. This compound plays a crucial role in the production of various organic substances due to its unique structural properties and reactivity.One of the key applications of 1-Nitro-4-(tert-pentyl)benzene in chemical synthesis is in the synthesis of complex organic molecules. Its nitro functional group can undergo several important reactions, such as reduction, substitution, and coupling reactions, which are essential for building intricate molecular structures.Additionally, the tert-pentyl group attached to the benzene ring provides steric hindrance, making it an ideal precursor for synthesizing chiral compounds. This feature is particularly valuable in pharmaceutical synthesis, where enantiomerically pure compounds are often required for biological activity.Furthermore, 1-Nitro-4-(tert-pentyl)benzene can serve as a valuable starting material for the preparation of various functionalized benzene derivatives, which are commonly used in the production of dyes, perfumes, and agrochemicals.Overall, the versatility and reactivity of 1-Nitro-4-(tert-pentyl)benzene make it a crucial component in chemical synthesis, enabling the creation of diverse organic compounds with a wide range of applications.