
Catalog Number	AR00EEX9
Chemical Name	4-Chloro-3-methoxyphenylboronic acid pinacolester
CAS Number	627525-96-6
Molecular Formula	C13H18BClO3
Molecular Weight	268.5442
MDL Number	MFCD13176538
SMILES	COc1cc(ccc1Cl)B1OC(C(O1)(C)C)(C)C

The compound 2-(4-Chloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane plays a crucial role in chemical synthesis as a valuable boronic ester intermediate. It is commonly utilized in Suzuki-Miyaura cross-coupling reactions, a powerful and widely employed method for forming carbon-carbon bonds in organic synthesis. This compound facilitates the incorporation of the 4-chloro-3-methoxyphenyl group into various organic molecules, enabling the efficient construction of complex structures with high regio- and stereo-selectivity. Additionally, the unique steric and electronic properties of this boronic ester contribute to its versatility and utility in the preparation of pharmaceuticals, agrochemicals, and advanced materials.