
Catalog Number	AR00ECNM
Chemical Name	7-NITRO-3,4-DIHYDROISOQUINOLINE
CAS Number	62541-59-7
Molecular Formula	C9H8N2O2
Molecular Weight	176.172
MDL Number	MFCD01529683
SMILES	[O-][N+](=O)c1ccc2c(c1)C=NCC2

7-Nitro-3,4-dihydroisoquinoline is a versatile compound widely used in chemical synthesis due to its unique properties. It serves as a valuable building block in organic chemistry, particularly in the preparation of various pharmaceuticals, agrochemicals, and materials. Its structure contains a nitro group and a dihydroisoquinoline backbone, which can undergo various transformations to yield a wide range of functionalized products. In chemical synthesis, 7-Nitro-3,4-dihydroisoquinoline can undergo reduction reactions to yield 3,4-dihydroisoquinolines, which are important intermediates in the synthesis of biologically active compounds. Additionally, the nitro group can be selectively reduced to an amino group, allowing for further derivatization and diversification of the molecule.Moreover, the unique reactivity of 7-Nitro-3,4-dihydroisoquinoline enables it to participate in various cyclization reactions, leading to the formation of heterocyclic compounds with potential pharmacological activities. Its structural features make it a valuable tool in the construction of complex molecules in medicinal chemistry and drug discovery.Overall, 7-Nitro-3,4-dihydroisoquinoline plays a crucial role in chemical synthesis by providing a strategic entry point for the preparation of diverse organic compounds with applications in the pharmaceutical and material science industries.