
Catalog Number	AR00ELVZ
Chemical Name	Ethyl 5-(trifluoromethyl)isoxazole-3-carboxylate
CAS Number	625120-13-0
Molecular Formula	C7H6F3NO3
Molecular Weight	209.1226
MDL Number	MFCD18250570
SMILES	CCOC(=O)c1noc(c1)C(F)(F)F

Ethyl 5-(trifluoromethyl)-3-isoxazolecarboxylate serves as a versatile building block in chemical synthesis. Its unique structure containing a trifluoromethyl group and an isoxazole ring provides distinct chemical reactivity, making it valuable for the preparation of various organic compounds. This compound can be used in the synthesis of pharmaceuticals, agrochemicals, and functional materials due to its ability to introduce the trifluoromethyl moiety and isoxazole motif into target molecules. Additionally, the ester functionality of ethyl 5-(trifluoromethyl)-3-isoxazolecarboxylate allows for further derivatization, enabling the modification of its properties for specific applications in organic chemistry.