
Catalog Number	AR00F677
Chemical Name	2α,3β,23-Trihydroxyolean-12-en-28-oic acid β-D-glucopyranosyl ester
CAS Number	62369-72-6
Molecular Formula	C36H58O10
Molecular Weight	650.8397
SMILES	OC[C@H]1O[C@@H](OC(=O)[C@@]23CCC(CC3C3=CCC4[C@@]([C@@]3(CC2)C)(C)CCC2[C@]4(C)C[C@H]([C@@H]([C@@]2(C)CO)O)O)(C)C)[C@@H]([C@H]([C@@H]1O)O)O

Arjunoglucoside II, a natural compound derived from the medicinal herb Terminalia arjuna, has found versatile applications in chemical synthesis. This bioactive molecule serves as a valuable building block in the creation of novel pharmaceuticals, agrochemicals, and functional materials due to its unique chemical structure and diverse reactivity profile.In chemical synthesis, Arjunoglucoside II acts as a key precursor in the development of bioactive compounds with potential therapeutic properties. Its structural motifs can be modified through various synthetic strategies to introduce specific functional groups or improve biological activity. By serving as a starting material or intermediate in organic reactions, this compound facilitates the preparation of structurally complex molecules with improved efficiency and selectivity.Moreover, the presence of glycosidic linkages in Arjunoglucoside II enables researchers to explore carbohydrate chemistry and glycosylation methods for the synthesis of carbohydrate-based compounds. These molecules play essential roles in biological recognition processes and can be utilized in drug discovery, crop protection, and material science applications.Overall, the application of Arjunoglucoside II in chemical synthesis offers a promising avenue for the development of innovative molecules with potential bioactive properties and functional applications. Through strategic manipulation of its chemical structure, researchers can harness the unique reactivity of this natural product to access a diverse array of compounds with enhanced biological, agricultural, or material-related functions.