
Catalog Number	AR01SX8J
Chemical Name	4H-1-Benzopyran-4-one, 7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-methoxy-
CAS Number	62346-14-9
Molecular Formula	C17H14O6
Molecular Weight	314.2895
SMILES	COc1cc(ccc1O)c1cc(=O)c2c(o1)cc(cc2OC)O

Luteolin 5,3′-dimethyl ether, also known as diosmetin, is a natural compound with potential applications in chemical synthesis. This derivative of luteolin offers unique properties that make it a valuable reagent in organic chemistry. Due to its structural features, luteolin 5,3′-dimethyl ether can serve as a versatile building block for the synthesis of various biologically active compounds and pharmaceuticals. Its presence of two methyl groups at specific positions provides enhanced reactivity and selectivity in synthetic reactions. Chemists utilize luteolin 5,3′-dimethyl ether as a key intermediate in the preparation of novel drug candidates, natural product analogs, and functional materials. By leveraging its chemical properties, researchers can explore innovative pathways for the development of new molecules with potential therapeutic benefits.