
Catalog Number	AR00EJD8
Chemical Name	Orotirelin
CAS Number	62305-86-6
Molecular Formula	C16H19N7O5
Molecular Weight	389.366
MDL Number	MFCD00867367
SMILES	O=c1[nH]c(=O)[nH]c(c1)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N)Cc1nc[nH]c1

Orotirelin, a peptide hormone, finds application in chemical synthesis as a key building block for the development of novel pharmaceutical compounds. By serving as a foundational component in the creation of synthetic molecules, Orotirelin plays a crucial role in the production of medications and research chemicals. Its unique structure and properties make it an indispensable tool for chemists and researchers looking to design and produce bioactive compounds with targeted effects. In the realm of chemical synthesis, Orotirelin opens up possibilities for the creation of innovative drugs and materials that could potentially lead to groundbreaking advancements in the field of medicine and beyond.