
Catalog Number	AR00IBOY
Chemical Name	Benzoic acid, 4-(trifluoroacetyl)-, methyl ester
CAS Number	62263-12-1
Molecular Formula	C10H7F3O3
Molecular Weight	232.1560
MDL Number	MFCD25965464
SMILES	COC(=O)c1ccc(cc1)C(=O)C(F)(F)F

4-(trifluoroacetyl)-methyl benzoate is a versatile compound widely used in chemical synthesis. As an ester derivative of benzoic acid, it serves as a valuable building block for the creation of various organic compounds. Its unique trifluoroacetyl group confers exceptional stability and reactivity, making it a favored reagent in modern synthetic chemistry. This compound is commonly employed as a precursor in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. Its ability to undergo diverse chemical transformations, including acylation, alkylation, and reduction reactions, underscores its pivotal role in the synthesis of complex molecules. High purity 4-(trifluoroacetyl)-methyl benzoate is essential for achieving optimal results in organic synthesis, making it an indispensable tool for chemists in both academia and industry.