
Catalog Number	AR00EAJ5
Chemical Name	TERT-BUTYL 4-[4-(HYDROXYMETHYL)BENZYL]TETRAHYDRO-1(2H)-PYRAZINECARBOXYLATE
CAS Number	622381-67-3
Molecular Formula	C17H26N2O3
Molecular Weight	306.3999
MDL Number	MFCD06658975
SMILES	OCc1ccc(cc1)CN1CCN(CC1)C(=O)OC(C)(C)C

The tert-Butyl 4-(4-(hydroxymethyl)benzyl)piperazine-1-carboxylate is a versatile compound commonly utilized in chemical synthesis processes. Its unique chemical structure makes it a valuable building block in the creation of various pharmaceuticals, agrochemicals, and functional materials. Specifically, this compound is employed in the synthesis of complex organic molecules due to its ability to serve as a key intermediate in multi-step reactions. Its presence enables the manipulation of molecular structures to achieve desired properties and functionalities in the final products. Additionally, tert-Butyl 4-(4-(hydroxymethyl)benzyl)piperazine-1-carboxylate plays a crucial role in the development of innovative drug candidates and specialty chemicals, highlighting its significance in the field of chemical synthesis.