
Catalog Number	AR01DY35
Chemical Name	2H-Imidazo[4,5-b]pyridin-2-one, 3-(1,3-benzodioxol-5-yl)-1,3-dihydro-
CAS Number	61962-84-3
Molecular Formula	C13H9N3O3
Molecular Weight	255.2289
SMILES	O=c1[nH]c2c(n1c1ccc3c(c1)OCO3)nccc2

The compound 3-(1,3-Benzodioxol-5-yl)-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one serves as a versatile building block in the realm of chemical synthesis. Its unique molecular structure allows for strategic manipulation and functionalization, making it a valuable tool in the creation of novel organic compounds. This compound can be employed in a variety of synthetic pathways, such as the formation of complex heterocyclic structures, the synthesis of pharmacologically relevant molecules, and the development of bioactive compounds with potential therapeutic applications. In the hands of skilled chemists, this compound offers a promising avenue for the exploration of new chemical entities and the advancement of synthetic methodologies.