
Catalog Number	AR00E9G9
Chemical Name	REACTIVE YELLOW 86
CAS Number	61951-86-8
Molecular Formula	C18H14Cl2N8Na2O9S2
Molecular Weight	667.3675
MDL Number	MFCD28385828
SMILES	CCN1C(=O)/C(=N\Nc2cc(Nc3nc(Cl)nc(n3)Cl)c(cc2S(=O)(=O)[O-])S(=O)(=O)[O-])/C(=C(C1=O)C(=O)N)C.[Na+].[Na+]

Reactive Yellow 86, also known by its chemical name C.I. Reactive Yellow 86, is a widely used dye in chemical synthesis processes. This reactive dye is commonly employed in various industries and applications due to its unique properties and versatility. In chemical synthesis, Reactive Yellow 86 is utilized as a key component in the manufacturing of colored materials such as textiles, plastics, and paper products. Its reactive nature allows for strong and permanent bonding with the substrate, resulting in vibrant and long-lasting coloration. Additionally, Reactive Yellow 86 is known for its excellent lightfastness and washfastness properties, making it ideal for use in products that require durability and resistance to fading. This versatile dye plays a crucial role in the creation of a wide range of colored products, making it a valuable asset in the field of chemical synthesis.