
Catalog Number	AR00EKVQ
Chemical Name	Oleanolic acid-3-O-beta-D-xylopyranoside
CAS Number	61617-29-6
Molecular Formula	C35H56O7
Molecular Weight	588.8149
MDL Number	MFCD26406120
SMILES	O[C@@H]1CO[C@H]([C@@H]([C@H]1O)O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C)(C)CC1)C(=O)O)C)C

Songoroside A is a naturally occurring compound that has found significant applications in chemical synthesis. Due to its unique structure and reactivity, Songoroside A serves as a valuable building block in the creation of new pharmaceuticals, agrochemicals, and materials. When used in chemical reactions, Songoroside A can act as a key intermediate, enabling the formation of complex molecular structures with enhanced functionalities. Its versatility in various synthetic pathways makes it an indispensable tool for chemists seeking to develop novel compounds with improved properties. By harnessing the chemical properties of Songoroside A, researchers can accelerate the discovery and production of innovative chemical substances for a wide range of applications.