
Catalog Number	AR00EC11
Chemical Name	5-ETHYNYL-DU CEP
CAS Number	615288-66-9
Molecular Formula	C41H47N4O8P
Molecular Weight	754.8076
MDL Number	MFCD08062044
SMILES	N#CCCOP(N(C(C)C)C(C)C)O[C@H]1C[C@@H](O[C@@H]1COC(c1ccc(cc1)OC)(c1ccc(cc1)OC)c1ccccc1)n1cc(C#C)c(=O)[nH]c1=O

Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy-5-ethynyl-, 3'-[2-cyanoethyl N, N-bis(1-methylethyl)phosphoramidite] is a key reagent utilized in chemical synthesis processes such as oligonucleotide synthesis. This specialized compound plays a crucial role in the efficient and controlled synthesis of nucleic acid sequences by serving as a phosphoramidite building block. By incorporating this unique uridine derivative during the synthesis of oligonucleotides, researchers and chemists can achieve precise and high-yielding synthetic routes for the production of custom DNA and RNA sequences tailored to specific research or industrial applications.