
Catalog Number	AR00EIX1
Chemical Name	6,8-DIHYDROXYPYRENE-1,3-DISULFONIC ACID DISODIUM SALT
CAS Number	61255-63-8
Molecular Formula	C16H8Na2O8S2
Molecular Weight	438.3395
MDL Number	MFCD00800283
SMILES	Oc1cc(O)c2c3c1ccc1c3c(cc2)c(cc1S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]

Sodium 6,8-dihydroxypyrene-1,3-disulfonate is a versatile compound widely utilized in chemical synthesis as a key intermediate for creating various complex organic molecules. Its unique structure allows for selective functionalization at multiple positions, enabling precise control over the synthesis process. This compound plays a crucial role in the development of novel dyes, pharmaceuticals, and other specialty chemicals due to its ability to facilitate diverse chemical transformations. In organic synthesis, Sodium 6,8-dihydroxypyrene-1,3-disulfonate serves as a valuable building block, providing a foundation for the construction of intricate molecular architectures with tailored properties and functionalities. Its reactivity and compatibility with a range of reaction conditions make it an essential component in the arsenal of synthetic chemists striving to design and access new compounds for various applications.