
Catalog Number	AR00EF6Z
Chemical Name	2-PHENYL-4'-TRIFLUOROMETHYLACETOPHENONE
CAS Number	61062-55-3
Molecular Formula	C15H11F3O
Molecular Weight	264.2424
MDL Number	MFCD02260678
SMILES	O=C(c1ccc(cc1)C(F)(F)F)Cc1ccccc1

Ethanone, 2-phenyl-1-[4-(trifluoromethyl)phenyl]- is a versatile compound used extensively in chemical synthesis. This compound serves as a valuable reagent in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure with a trifluoromethylphenyl group offers opportunities for introducing fluorine-containing motifs into organic molecules, which can enhance their biological activity or chemical properties. In addition, Ethanone, 2-phenyl-1-[4-(trifluoromethyl)phenyl]- is employed in the preparation of complex intermediates for the production of advanced materials and functional polymers. Its application in asymmetric synthesis and catalysis further highlights its significance in modern organic chemistry.