
Catalog Number	AR00EB1U
Chemical Name	5-NITRO-2-HYDROXY-4-METHOXYPYRIDINE
CAS Number	607373-82-0
Molecular Formula	C6H6N2O4
Molecular Weight	170.1228
MDL Number	MFCD07367779
SMILES	COc1cc(=O)[nH]cc1[N+](=O)[O-]

4-Methoxy-5-nitropyridin-2(1H)-one is a versatile compound widely utilized in chemical synthesis as a key building block for the preparation of various organic molecules. This compound serves as a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its unique reactivity and functional groups. In organic synthesis, 4-Methoxy-5-nitropyridin-2(1H)-one is employed as a precursor in the construction of heterocyclic compounds, such as pyridine derivatives, which are important structural motifs found in many bioactive molecules. Additionally, its nitro and methoxy groups can be selectively modified to introduce specific functionalities, enabling the fine-tuning of molecular properties. This compound plays a crucial role in synthetic chemistry by facilitating the creation of diverse molecular architectures with targeted properties for various applications.