
Catalog Number	AR00EZM9
Chemical Name	2-[[(2-hydroxyethyl)methylamino]methyl]benzhydryl alcohol
CAS Number	60725-36-2
Molecular Formula	C17H21NO2
Molecular Weight	271.3541
MDL Number	MFCD19303791
SMILES	OCCN(Cc1ccccc1C(c1ccccc1)O)C

2-[[(2-Hydroxyethyl)methylamino]methyl]-α-phenylbenzenemethanol is a versatile compound often utilized in chemical synthesis as a key building block. Its application lies in its ability to serve as a vital intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. With its unique structural properties, this compound plays a crucial role in the creation of complex organic molecules through synthetic routes such as reductive amination, Friedel-Crafts acylation, and Grignard reactions. Additionally, its functional groups enable further modifications, making it a valuable tool for designing and synthesizing novel compounds with tailored properties for a wide range of industrial applications.