
Catalog Number	AR00EMD0
Chemical Name	Bis(4-nitrophenyl) diketone
CAS Number	6067-45-4
Molecular Formula	C14H8N2O6
Molecular Weight	300.2231
MDL Number	MFCD01318532
SMILES	O=C(C(=O)c1ccc(cc1)[N+](=O)[O-])c1ccc(cc1)[N+](=O)[O-]

1,2-Bis(4-nitrophenyl)ethane-1,2-dione, also known as $name$, is a versatile compound commonly used in chemical synthesis. Due to its unique structure and properties, $name$ serves as a valuable building block in the creation of various organic compounds. In the field of organic chemistry, $name$ is particularly prized for its ability to participate in a range of reactions, making it indispensable for the synthesis of complex molecules. Its presence in a reaction mixture can facilitate the formation of new carbon-carbon and carbon-heteroatom bonds, leading to the creation of structurally diverse products. Additionally, $name$ can act as a dienophile in Diels-Alder reactions, enabling the construction of cyclic structures with high efficiency. Chemists often utilize $name$ as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials with tailored properties. Its role in organic synthesis highlights its significance as a fundamental building block in the creation of novel molecules with diverse applications in the chemical industry.