
Catalog Number	AR003GUY
Chemical Name	2，6-Dinitrobenzaldehyde
CAS Number	606-31-5
Molecular Formula	C7H4N2O5
Molecular Weight	196.1171
MDL Number	MFCD00007133
SMILES	O=Cc1c(cccc1[N+](=O)[O-])[N+](=O)[O-]

2,6-Dinitrobenzaldehyde is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. This compound serves as a key building block in the preparation of various organic molecules and is particularly valued for its role as a precursor in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. With its distinct structure and functional groups, 2,6-Dinitrobenzaldehyde enables chemists to introduce specific functionalities into target molecules, facilitating the creation of new and diverse chemical structures. In addition, this compound has been employed in the development of fluorescent dyes, polymer additives, and other specialized compounds due to its ability to undergo various chemical transformations such as reduction, oxidation, and condensation reactions. As a valuable tool in organic synthesis, 2,6-Dinitrobenzaldehyde continues to play a crucial role in advancing research and innovation in the field of chemistry.