
Catalog Number	AR00EAD1
Chemical Name	PINACIDIL
CAS Number	60560-33-0
Molecular Formula	C13H19N5
Molecular Weight	245.3235
MDL Number	MFCD00242745
SMILES	CC(C(C)(C)C)/N=C(\Nc1ccncc1)/NC#N

Pinacidil is a potent vasodilator that belongs to the class of potassium channel openers. It has a wide range of applications in chemical synthesis, particularly in the pharmaceutical industry. In organic chemistry, Pinacidil is used as a key component in the synthesis of various heterocyclic compounds. Its ability to activate ATP-sensitive potassium channels makes it a valuable tool in drug discovery and development.Pinacidil's unique properties allow for the modulation of cellular processes related to blood pressure regulation, making it a promising candidate for the treatment of hypertension and other cardiovascular disorders. Additionally, its role as a potassium channel opener enables researchers to explore novel drug targets and pathways in the field of medicinal chemistry.Overall, Pinacidil's versatile nature and pharmacological effects make it an essential reagent in chemical synthesis, particularly in the development of therapeutic agents targeting cardiovascular diseases.