
Catalog Number	AR01B4ZU
Chemical Name	2-[(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}phenyl)formamido]pentanedioic acid
CAS Number	60388-53-6
Molecular Formula	C20H22N8O5
Molecular Weight	454.4393
MDL Number	MFCD00064369
SMILES	OC(=O)CCC(C(=O)O)NC(=O)c1ccc(cc1)N(Cc1cnc2c(n1)c(N)nc(n2)N)C

DL-Amethopterin, also known as methotrexate, is a versatile compound commonly used in chemical synthesis due to its potent inhibitory effects on enzymes involved in folic acid metabolism. Its application in synthesis primarily revolves around its ability to disrupt folate-dependent pathways, making it a valuable tool in the development of antitumor and antimicrobial agents.DL-Amethopterin's mechanism of action lies in its capability to inhibit dihydrofolate reductase, an enzyme crucial for the synthesis of nucleotides. By interfering with this key step in nucleic acid production, DL-Amethopterin disrupts the growth and proliferation of malignant cells, making it an essential component in the design of anticancer drugs.Furthermore, DL-Amethopterin's inhibitory effects on folate metabolism also extend to microbial cells, making it an effective agent against a wide range of bacterial and fungal infections. Its broad-spectrum activity and relatively low toxicity in comparison to other antimicrobial agents further highlight its significance in chemical synthesis for developing novel therapeutic agents.Overall, DL-Amethopterin's unique mechanism of action and versatility make it a valuable compound in chemical synthesis for the design and development of various pharmaceuticals targeting cancer and infectious diseases.