
Catalog Number	AR01FRWJ
Chemical Name	Dichlorotetrakis(2-phenylpyridyl)diiridium
CAS Number	603109-48-4
Molecular Formula	C44H32Cl2Ir2N4
Molecular Weight	1072.0917
MDL Number	MFCD28144567
SMILES	C1=CC=[C-]2C(=C1)C1=CC=CC=[N]1[Ir+3]132([Cl-][Ir+3]24([Cl-]1)([C-]1=C(C5=[N]4C=CC=C5)C=CC=C1)[C-]1=C(C4=[N]2C=CC=C4)C=CC=C1)[C-]1=C(C2=[N]3C=CC=C2)C=CC=C1

Dichlorotetrakis(2-phenylpyridyl)diiridium is a versatile and valuable catalyst widely utilized in various chemical synthesis processes. This compound plays a crucial role in catalyzing a range of organic transformations, including carbon-carbon bond formation, hydrogenation reactions, and cross-coupling reactions. Its exceptional catalytic properties make it particularly useful in the pharmaceutical industry for the efficient production of complex organic molecules. Furthermore, Dichlorotetrakis(2-phenylpyridyl)diiridium offers high selectivity and efficiency, making it an essential tool for chemists seeking to streamline their synthetic strategies and enhance the overall yield of their desired products.