
Catalog Number	AR003I43
Chemical Name	2-Hydroxy-6-nitrobenzoic acid
CAS Number	601-99-0
Molecular Formula	C7H5NO5
Molecular Weight	183.1183
MDL Number	MFCD00031281
SMILES	[O-][N+](=O)c1cccc(c1C(=O)O)O

2-Hydroxy-6-nitrobenzoic acid, also known as Salicylic acid-6-nitro, is a key chemical compound widely used in various chemical synthesis applications. One of its primary uses is as a precursor in the synthesis of pharmaceuticals, agrochemicals, and dyes. Its unique chemical structure allows it to participate in a variety of organic reactions, making it a versatile building block in the field of synthetic chemistry. With its combined hydroxyl and nitro functional groups, 2-Hydroxy-6-nitrobenzoic acid can undergo diverse transformations including esterification, nitration, and reduction, enabling the creation of a wide range of new chemical entities. Additionally, the presence of the hydroxyl group in its structure provides the potential for selective derivatization, leading to the synthesis of more complex molecules. This compound plays a pivotal role in the development of novel compounds with potential applications in pharmaceutical research, material science, and other industries requiring advanced chemical synthesis capabilities.