
Catalog Number	AR00EM4R
Chemical Name	Carboxyaminoimidazole ribotide
CAS Number	6001-14-5
Molecular Formula	C9H14N3O9P
Molecular Weight	339.1959
MDL Number	MFCD00870350
SMILES	O[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc(c1N)C(=O)O)COP(=O)(O)O

CAIR, or Controlled Atmosphere Infrared, is a versatile tool used in chemical synthesis to ensure precise control over reaction conditions. By creating a controlled atmosphere within the reaction vessel, CAIR technology allows chemists to manipulate and optimize reaction parameters such as temperature, pressure, and gas composition in real-time. This level of control is crucial in achieving high yields, selectivity, and purity in chemical reactions, making CAIR an invaluable asset in organic and inorganic synthesis. Additionally, CAIR can also enable chemists to study reaction kinetics, mechanism, and intermediates more effectively, leading to a deeper understanding of complex chemical processes.