
Catalog Number	AR00EIVA
Chemical Name	Carlinoside
CAS Number	59952-97-5
Molecular Formula	C26H28O15
Molecular Weight	580.4915
MDL Number	MFCD02259465
SMILES	OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)c([C@@H]2OC[C@@H]([C@@H]([C@H]2O)O)O)c2c(c1O)c(=O)cc(o2)c1ccc(c(c1)O)O

Carlinoside is a versatile compound that finds applications in various chemical synthesis processes. Its unique chemical structure and reactivity make it a valuable reagent for organic synthesis and pharmaceutical research. In particular, Carlinoside is commonly used as a key intermediate in the synthesis of complex natural products and bioactive compounds. Its ability to undergo diverse chemical transformations, such as functional group manipulations and selective reactions, enables chemists to access a wide range of molecular structures efficiently. Furthermore, Carlinoside's compatibility with various reaction conditions and its high chemical stability make it a reliable building block for the design and preparation of novel molecules with desired properties. By incorporating Carlinoside into synthesis strategies, researchers can streamline the development of new drugs, agrochemicals, and materials with enhanced functionalities and potential therapeutic benefits.